
CAS 832737-59-4
:1-[(4-Ethoxyphenoxy)methyl]-3-nitrobenzene
Description:
1-[(4-Ethoxyphenoxy)methyl]-3-nitrobenzene, identified by its CAS number 832737-59-4, is an organic compound characterized by its complex molecular structure, which includes a nitro group, an ethoxy group, and a phenoxy linkage. This compound typically exhibits a moderate to high molecular weight and is likely to be a solid at room temperature, given the presence of aromatic rings that contribute to its stability. The nitro group (-NO2) is known for its electron-withdrawing properties, which can influence the compound's reactivity and polarity. The ethoxy group (-OCH2CH3) enhances solubility in organic solvents and may affect the compound's overall hydrophobicity. Additionally, the phenoxy group can participate in various chemical reactions, making this compound potentially useful in synthetic organic chemistry or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as compounds with nitro groups can be sensitive to heat and shock.
Formula:C15H15NO4
InChI:InChI=1S/C15H15NO4/c1-2-19-14-6-8-15(9-7-14)20-11-12-4-3-5-13(10-12)16(17)18/h3-10H,2,11H2,1H3
InChI key:InChIKey=DJYWZXDFSPMMTR-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(OCC)C=C1)C2=CC(N(=O)=O)=CC=C2
Synonyms:- Benzene, 1-[(4-ethoxyphenoxy)methyl]-3-nitro-
- 1-[(4-Ethoxyphenoxy)methyl]-3-nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.