CymitQuimica logo

CAS 832737-68-5

:

4-Methyl-5-(4-methylphenyl)-2-thiophenecarboxylic acid

Description:
4-Methyl-5-(4-methylphenyl)-2-thiophenecarboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of methyl groups on both the thiophene and phenyl rings enhances its hydrophobic characteristics and may influence its solubility in organic solvents. The compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, particularly due to the presence of the thiophene moiety, which is known for its electronic properties. Additionally, the substitution patterns on the aromatic rings can affect the compound's reactivity and interaction with biological systems. As with many organic acids, it may exhibit behavior such as proton donation in solution, influencing its pH-dependent properties. Overall, 4-Methyl-5-(4-methylphenyl)-2-thiophenecarboxylic acid is a compound of interest for its unique structural features and potential applications in various chemical fields.
Formula:C13H12O2S
InChI:InChI=1S/C13H12O2S/c1-8-3-5-10(6-4-8)12-9(2)7-11(16-12)13(14)15/h3-7H,1-2H3,(H,14,15)
InChI key:InChIKey=HULPUUKNFULTMO-UHFFFAOYSA-N
SMILES:CC1=C(SC(C(O)=O)=C1)C2=CC=C(C)C=C2
Synonyms:
  • 2-Thiophenecarboxylic acid, 4-methyl-5-(4-methylphenyl)-
  • 4-Methyl-5-(4-methylphenyl)-2-thiophenecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.