CAS 832737-73-2

5-[(3-Methyl-4-nitrophenoxy)methyl]-2-furancarboxylic acid

Description:

5-[(3-Methyl-4-nitrophenoxy)methyl]-2-furancarboxylic acid is an organic compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. The presence of a nitrophenyl moiety contributes to its potential as a bioactive compound, possibly exhibiting antibacterial or antifungal properties. The methyl and nitro substituents on the aromatic ring can influence the compound's reactivity and solubility, making it of interest in medicinal chemistry and material science. This compound may also exhibit specific optical properties due to its conjugated system, which can be relevant in applications such as dye synthesis or as a fluorescent marker. Additionally, the carboxylic acid group can participate in various chemical reactions, including esterification and amidation, enhancing its versatility in synthetic chemistry. Overall, the characteristics of this compound suggest potential applications in pharmaceuticals, agrochemicals, and advanced materials, warranting further investigation into its biological and chemical properties.

Formula: C₁₃H₁₁NO₆

InChI: InChI=1S/C13H11NO6/c1-8-6-9(2-4-11(8)14(17)18)19-7-10-3-5-12(20-10)13(15)16/h2-6H,7H2,1H3,(H,15,16)

InChI key: InChIKey=CEVRYRJNYZJMKC-UHFFFAOYSA-N

SMILES: C(OC1=CC(C)=C(N(=O)=O)C=C1)C=2OC(C(O)=O)=CC2

Synonyms:

• 2-Furancarboxylic acid, 5-[(3-methyl-4-nitrophenoxy)methyl]-
• 5-[(3-Methyl-4-nitrophenoxy)methyl]-2-furancarboxylic acid