CAS 832737-74-3

5-[[2-(2-Propen-1-yl)phenoxy]methyl]-2-furancarboxylic acid

Description:

5-[[2-(2-Propen-1-yl)phenoxy]methyl]-2-furancarboxylic acid, identified by its CAS number 832737-74-3, is an organic compound characterized by its unique structure that includes a furan ring and a phenoxy group. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the propenyl group indicates that it may participate in various chemical reactions, such as polymerization or addition reactions, making it of interest in synthetic organic chemistry. Its furan moiety can also engage in electrophilic aromatic substitution reactions, enhancing its versatility in chemical synthesis. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its applications in pharmaceuticals or agrochemicals. Overall, this compound's distinctive structural features and functional groups suggest potential utility in various chemical applications, including as an intermediate in the synthesis of more complex molecules.

Formula: C₁₅H₁₄O₄

InChI: InChI=1S/C15H14O4/c1-2-5-11-6-3-4-7-13(11)18-10-12-8-9-14(19-12)15(16)17/h2-4,6-9H,1,5,10H2,(H,16,17)

InChI key: InChIKey=ILZUAUFGUYBHLK-UHFFFAOYSA-N

SMILES: O(CC=1OC(C(O)=O)=CC1)C2=C(CC=C)C=CC=C2

Synonyms:

• 2-Furancarboxylic acid, 5-[[2-(2-propenyl)phenoxy]methyl]-
• 5-[[2-(2-Propen-1-yl)phenoxy]methyl]-2-furancarboxylic acid
• 2-Furancarboxylic acid, 5-[[2-(2-propen-1-yl)phenoxy]methyl]-

5-{[2-(Prop-2-en-1-yl)phenoxy]methyl}furan-2-carboxylic acid

CAS: 832737-74-3

Versatile small molecule scaffold

Formula: C₁₅H₁₄O₄

Purity: Min. 95%

Molecular weight: 258.27 g/mol

Ref: 3D-HIB73774