CymitQuimica logo

CAS 832737-80-1

:

3-[(4-Methyl-2-nitrophenoxy)methyl]benzoic acid hydrazide

Description:
3-[(4-Methyl-2-nitrophenoxy)methyl]benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This substance features a phenoxy group substituted with a nitro and methyl group, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity and can influence its biological activity. The hydrazide moiety is known for its potential applications in pharmaceuticals, particularly in the synthesis of various bioactive compounds. This compound may exhibit properties such as solubility in organic solvents, and its stability can be influenced by the pH of the environment. Additionally, the structural complexity suggests potential interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as the nitro group can pose hazards. Overall, this compound's unique structure and functional groups make it a subject of interest for further research and application in various fields.
Formula:C15H15N3O4
InChI:InChI=1S/C15H15N3O4/c1-10-5-6-14(13(7-10)18(20)21)22-9-11-3-2-4-12(8-11)15(19)17-16/h2-8H,9,16H2,1H3,(H,17,19)
InChI key:InChIKey=OYIOLEOCFFHCAY-UHFFFAOYSA-N
SMILES:O(CC1=CC(C(NN)=O)=CC=C1)C2=C(N(=O)=O)C=C(C)C=C2
Synonyms:
  • 3-[(4-Methyl-2-nitrophenoxy)methyl]benzoic acid hydrazide
  • Benzoic acid, 3-[(4-methyl-2-nitrophenoxy)methyl]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.