CAS 832737-84-5
:3-(Difluoromethyl)-5-(ethylthio)-4H-1,2,4-triazol-4-amine
Description:
3-(Difluoromethyl)-5-(ethylthio)-4H-1,2,4-triazol-4-amine is a chemical compound characterized by its unique triazole structure, which includes a difluoromethyl group and an ethylthio substituent. This compound typically exhibits properties associated with triazoles, such as potential biological activity, making it of interest in pharmaceutical research. The difluoromethyl group can enhance lipophilicity and influence the compound's interaction with biological targets, while the ethylthio group may contribute to its solubility and stability. The presence of an amine functional group suggests potential for hydrogen bonding, which can affect its reactivity and interaction with other molecules. Additionally, this compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 3-(Difluoromethyl)-5-(ethylthio)-4H-1,2,4-triazol-4-amine represents a class of compounds that may have applications in agrochemicals or pharmaceuticals, particularly in the development of antifungal or antimicrobial agents.
Formula:C5H8F2N4S
InChI:InChI=1S/C5H8F2N4S/c1-2-12-5-10-9-4(3(6)7)11(5)8/h3H,2,8H2,1H3
InChI key:InChIKey=DFKHPFQZSYBRFJ-UHFFFAOYSA-N
SMILES:C(F)(F)C=1N(N)C(SCC)=NN1
Synonyms:- 3-(Difluoromethyl)-5-(ethylthio)-4H-1,2,4-triazol-4-amine
- 4H-1,2,4-Triazol-4-amine, 3-(difluoromethyl)-5-(ethylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.