CAS 832737-85-6
:3-(ethoxymethyl)-4-methoxybenzaldehyde
Description:
3-(Ethoxymethyl)-4-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features an ethoxymethyl group and a methoxy group attached to the benzene ring, contributing to its unique chemical properties. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. The ethoxy group enhances its solubility in organic solvents, while the methoxy group can influence its reactivity and polarity. This compound may exhibit moderate to high volatility and can be sensitive to light and moisture, necessitating careful handling and storage. Its applications may span across fields such as organic synthesis, pharmaceuticals, and materials science, where it could serve as an intermediate or a building block for more complex molecules. As with many organic compounds, safety precautions should be observed when working with this substance due to potential toxicity and reactivity.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c1-3-14-8-10-6-9(7-12)4-5-11(10)13-2/h4-7H,3,8H2,1-2H3
SMILES:CCOCc1cc(ccc1OC)C=O
Synonyms:- 3-Ethoxymethyl-4-methoxy-benzaldehyde
- Benzaldehyde, 3-(ethoxymethyl)-4-methoxy-
- 3-(Ethoxymethyl)-4-methoxybenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.