CAS 832737-86-7

2-(Ethylsulfonyl)-4-methyl-6-(trifluoromethyl)pyrimidine

Description:

2-(Ethylsulfonyl)-4-methyl-6-(trifluoromethyl)pyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features an ethylsulfonyl group, which contributes to its solubility and reactivity, and a trifluoromethyl group that enhances its biological activity and lipophilicity. The presence of the methyl group at position 4 of the pyrimidine ring adds to its steric properties. This compound is often studied for its potential applications in pharmaceuticals, particularly as a building block in the synthesis of biologically active molecules. Its unique functional groups may impart specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the trifluoromethyl group is known to influence the compound's electronic properties, potentially affecting its reactivity and stability. Overall, 2-(Ethylsulfonyl)-4-methyl-6-(trifluoromethyl)pyrimidine is a versatile compound with significant implications in chemical research and drug development.

Formula: C₈H₉F₃N₂O₂S

InChI: InChI=1S/C8H9F3N2O2S/c1-3-16(14,15)7-12-5(2)4-6(13-7)8(9,10)11/h4H,3H2,1-2H3

InChI key: InChIKey=MJDBKUMSJOXZER-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)C=1N=C(C(F)(F)F)C=C(C)N1

Synonyms:

• 2-(Ethylsulfonyl)-4-methyl-6-(trifluoromethyl)pyrimidine
• Pyrimidine, 2-(ethylsulfonyl)-4-methyl-6-(trifluoromethyl)-