CAS 832737-87-8
:5-[(2-Chloro-6-methylphenoxy)methyl]-2-furancarboxylic acid
Description:
5-[(2-Chloro-6-methylphenoxy)methyl]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. The presence of the chloro and methyl substituents on the aromatic ring contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while the carboxylic acid group may enhance its solubility in polar solvents. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly as a building block for more complex molecules. The compound's reactivity can be influenced by the electron-withdrawing nature of the chloro group and the electron-donating properties of the methyl group, which may affect its interactions in various chemical environments. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks such as irritation or toxicity. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H11ClO4
InChI:InChI=1S/C13H11ClO4/c1-8-3-2-4-10(14)12(8)17-7-9-5-6-11(18-9)13(15)16/h2-6H,7H2,1H3,(H,15,16)
InChI key:InChIKey=IJRZZPXUKJUXDF-UHFFFAOYSA-N
SMILES:O(CC=1OC(C(O)=O)=CC1)C2=C(C)C=CC=C2Cl
Synonyms:- 5-[(2-Chloro-6-methylphenoxy)methyl]-2-furancarboxylic acid
- 2-Furancarboxylic acid, 5-[(2-chloro-6-methylphenoxy)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.