CAS 832737-88-9

3-Amino-1H-1,2,4-triazole-1-acetic acid hydrazide

Description:

3-Amino-1H-1,2,4-triazole-1-acetic acid hydrazide is a chemical compound characterized by its unique structure, which includes a triazole ring and an acetic acid hydrazide functional group. This compound typically exhibits properties such as being a solid at room temperature and may be soluble in polar solvents due to the presence of amino and hydrazide groups, which can engage in hydrogen bonding. It is often studied for its potential applications in pharmaceuticals, particularly as a building block in the synthesis of biologically active molecules. The presence of the triazole moiety may impart antifungal or antimicrobial properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit moderate stability under standard conditions, although it should be handled with care due to the potential reactivity of the hydrazide functional group. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines.

Formula: C₄H₈N₆O

InChI: InChI=1S/C4H8N6O/c5-4-7-2-10(9-4)1-3(11)8-6/h2H,1,6H2,(H2,5,9)(H,8,11)

InChI key: InChIKey=ACGVQDFRGRKMGS-UHFFFAOYSA-N

SMILES: C(C(NN)=O)N1N=C(N)N=C1

Synonyms:

• 1H-1,2,4-Triazole-1-acetic acid, 3-amino-, hydrazide
• 3-Amino-1H-1,2,4-triazole-1-acetic acid hydrazide