CymitQuimica logo

CAS 832737-89-0

:

3-[(2,5-Dimethylphenoxy)methyl]benzoic acid hydrazide

Description:
3-[(2,5-Dimethylphenoxy)methyl]benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This compound features a 2,5-dimethylphenoxy group attached to a methylene bridge, contributing to its unique structural properties. The presence of the hydrazide moiety suggests potential reactivity, particularly in forming hydrazones or undergoing condensation reactions. The compound may exhibit moderate to high solubility in organic solvents, depending on the specific substituents and their steric effects. Its molecular structure indicates potential applications in pharmaceuticals or agrochemicals, where hydrazides are often explored for their biological activity. Additionally, the presence of the aromatic rings may impart stability and influence the compound's interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would need to be assessed through empirical studies.
Formula:C16H18N2O2
InChI:InChI=1S/C16H18N2O2/c1-11-6-7-12(2)15(8-11)20-10-13-4-3-5-14(9-13)16(19)18-17/h3-9H,10,17H2,1-2H3,(H,18,19)
InChI key:InChIKey=SQXHTZLYNOPTPE-UHFFFAOYSA-N
SMILES:C(OC1=C(C)C=CC(C)=C1)C2=CC(C(NN)=O)=CC=C2
Synonyms:
  • 3-[(2,5-Dimethylphenoxy)methyl]benzoic acid hydrazide
  • Benzoic acid, 3-[(2,5-dimethylphenoxy)methyl]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.