CAS 832737-92-5

5-[(4-Bromo-2-chlorophenoxy)methyl]-2-furancarboxylic acid

Description:

5-[(4-Bromo-2-chlorophenoxy)methyl]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. The presence of a bromine and a chlorine atom on the aromatic ring contributes to its reactivity and potential biological activity. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential as a bioactive agent. Its molecular structure suggests it may exhibit properties such as antimicrobial or herbicidal activity, although specific biological effects would depend on further empirical studies. The compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring and the furan moiety. Safety and handling precautions are essential when working with this substance, as halogenated compounds can pose health risks. Overall, 5-[(4-Bromo-2-chlorophenoxy)methyl]-2-furancarboxylic acid represents a class of compounds that are of interest for their potential applications in various scientific fields.

Formula: C₁₂H₈BrClO₄

InChI: InChI=1S/C12H8BrClO4/c13-7-1-3-10(9(14)5-7)17-6-8-2-4-11(18-8)12(15)16/h1-5H,6H2,(H,15,16)

InChI key: InChIKey=GMUGPBYRNBSZIP-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)C=C(Br)C=C1)C=2OC(C(O)=O)=CC2

Synonyms:

• 5-[(4-Bromo-2-chlorophenoxy)methyl]-2-furancarboxylic acid
• 2-Furancarboxylic acid, 5-[(4-bromo-2-chlorophenoxy)methyl]-

5-(4-Bromo-2-chlorophenoxymethyl)furan-2-carboxylic acid

CAS: 832737-92-5

Versatile small molecule scaffold

Formula: C₁₂H₈BrClO₄

Purity: Min. 95%

Molecular weight: 331.54 g/mol

Ref: 3D-HIB73792