CAS 832737-94-7

1-(3,4-Dichlorophenyl)-4,4-difluoro-1,3-butanedione

Description:

1-(3,4-Dichlorophenyl)-4,4-difluoro-1,3-butanedione, identified by its CAS number 832737-94-7, is an organic compound characterized by its unique structure that includes a dichlorophenyl group and difluorobutanedione moiety. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, making it useful in various chemical applications. Its molecular structure suggests it may possess significant reactivity due to the presence of electrophilic carbonyl groups, which can participate in nucleophilic addition reactions. The dichlorophenyl substituent may enhance its biological activity, potentially making it relevant in pharmaceutical research or agrochemical applications. Additionally, the difluorinated groups can influence the compound's electronic properties and lipophilicity, affecting its interaction with biological systems. Safety data should be consulted, as halogenated compounds can exhibit toxicity or environmental persistence. Overall, this compound's unique characteristics make it a subject of interest in synthetic organic chemistry and related fields.

Formula: C₁₀H₆Cl₂F₂O₂

InChI: InChI=1S/C10H6Cl2F2O2/c11-6-2-1-5(3-7(6)12)8(15)4-9(16)10(13)14/h1-3,10H,4H2

InChI key: InChIKey=XAQWTATWWPFPLW-UHFFFAOYSA-N

SMILES: C(CC(C(F)F)=O)(=O)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• 1,3-Butanedione, 1-(3,4-dichlorophenyl)-4,4-difluoro-
• 1-(3,4-Dichlorophenyl)-4,4-difluoro-1,3-butanedione