CymitQuimica logo

CAS 832737-96-9

:

2-Chloro-1,3-bis(3,4-dimethoxyphenyl)-1,3-propanedione

Description:
2-Chloro-1,3-bis(3,4-dimethoxyphenyl)-1,3-propanedione, with the CAS number 832737-96-9, is an organic compound characterized by its complex structure featuring a propanedione backbone substituted with two 3,4-dimethoxyphenyl groups and a chlorine atom. This compound typically exhibits properties associated with diketones, including potential reactivity in condensation reactions and the ability to participate in various organic transformations due to the presence of the carbonyl groups. The methoxy groups enhance its solubility in organic solvents and may influence its electronic properties, making it a candidate for applications in organic synthesis and medicinal chemistry. Additionally, the chlorine substituent can affect the compound's reactivity and stability, potentially making it useful in the development of pharmaceuticals or agrochemicals. The presence of multiple aromatic rings suggests that it may also exhibit interesting optical properties, which could be relevant in materials science. Overall, this compound's unique structure and substituents contribute to its potential utility in various chemical applications.
Formula:C19H19ClO6
InChI:InChI=1S/C19H19ClO6/c1-23-13-7-5-11(9-15(13)25-3)18(21)17(20)19(22)12-6-8-14(24-2)16(10-12)26-4/h5-10,17H,1-4H3
InChI key:InChIKey=UTBCOLJEEYXSQU-UHFFFAOYSA-N
SMILES:C(C(C(=O)C1=CC(OC)=C(OC)C=C1)Cl)(=O)C2=CC(OC)=C(OC)C=C2
Synonyms:
  • 1,3-Propanedione, 2-chloro-1,3-bis(3,4-dimethoxyphenyl)-
  • 2-Chloro-1,3-bis(3,4-dimethoxyphenyl)-1,3-propanedione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.