CAS 832737-97-0

4-Methyl-5-[4-(1-methylethyl)phenyl]-2-thiophenecarboxylic acid

Description:

4-Methyl-5-[4-(1-methylethyl)phenyl]-2-thiophenecarboxylic acid, with the CAS number 832737-97-0, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a methyl group and an isopropyl-substituted phenyl group enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity. The molecular structure suggests that it may exhibit interesting biological activities, making it a candidate for pharmaceutical applications. Additionally, the compound's unique arrangement of substituents can affect its electronic properties, stability, and interactions with other molecules. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and environment. Overall, this compound's structural features suggest potential utility in various chemical and biological contexts, warranting further investigation into its properties and applications.

Formula: C₁₅H₁₆O₂S

InChI: InChI=1S/C15H16O2S/c1-9(2)11-4-6-12(7-5-11)14-10(3)8-13(18-14)15(16)17/h4-9H,1-3H3,(H,16,17)

InChI key: InChIKey=GBFPEJNVULONSA-UHFFFAOYSA-N

SMILES: CC1=C(SC(C(O)=O)=C1)C2=CC=C(C(C)C)C=C2

Synonyms:

• 4-Methyl-5-[4-(1-methylethyl)phenyl]-2-thiophenecarboxylic acid
• 2-Thiophenecarboxylic acid, 4-methyl-5-[4-(1-methylethyl)phenyl]-

4-Methyl-5-[4-(propan-2-yl)phenyl]thiophene-2-carboxylic acid

CAS: 832737-97-0

Versatile small molecule scaffold

Formula: C₁₅H₁₆O₂S

Purity: Min. 95%

Molecular weight: 260.4 g/mol

Ref: 3D-HIB73797