CAS 832737-98-1

N-Pentyl-5-phenyl-1,3,4-oxadiazole-2-methanamine

Description:

N-Pentyl-5-phenyl-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a pentyl group, which is a five-carbon alkyl chain, contributing to its hydrophobic characteristics. The presence of a phenyl group enhances its aromatic properties, potentially influencing its reactivity and interaction with other molecules. The methanamine functional group introduces basicity and can participate in hydrogen bonding, affecting solubility and biological activity. Generally, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The specific arrangement of substituents on the oxadiazole ring can significantly influence the compound's electronic properties, stability, and reactivity. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility would depend on the molecular structure and the interactions between molecules. Further studies would be necessary to fully elucidate its characteristics and potential applications.

Formula: C₁₄H₁₉N₃O

InChI: InChI=1S/C14H19N3O/c1-2-3-7-10-15-11-13-16-17-14(18-13)12-8-5-4-6-9-12/h4-6,8-9,15H,2-3,7,10-11H2,1H3

InChI key: InChIKey=WKGMUFSOCSNUOH-UHFFFAOYSA-N

SMILES: C(NCCCCC)C=1OC(=NN1)C2=CC=CC=C2

Synonyms:

• N-Pentyl-5-phenyl-1,3,4-oxadiazole-2-methanamine
• 1,3,4-Oxadiazole-2-methanamine, N-pentyl-5-phenyl-