CAS 832737-99-2

5-[(2,4-Dimethylphenoxy)methyl]-2-furancarboxylic acid hydrazide

Description:

5-[(2,4-Dimethylphenoxy)methyl]-2-furancarboxylic acid hydrazide, identified by its CAS number 832737-99-2, is a chemical compound characterized by its unique structural features, which include a furancarboxylic acid moiety and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and aromatic ethers, suggesting potential applications in pharmaceuticals or agrochemicals. The presence of the dimethylphenoxy group may impart lipophilicity, enhancing its ability to penetrate biological membranes. Additionally, the furancarboxylic acid structure can contribute to its reactivity and interaction with various biological targets. The compound's hydrazide functionality may also facilitate the formation of hydrazones or other derivatives, which can be useful in synthetic chemistry. Overall, this compound's characteristics, including its solubility, stability, and reactivity, would be influenced by its molecular structure, making it a subject of interest for further research and application in various fields.

Formula: C₁₄H₁₆N₂O₃

InChI: InChI=1S/C14H16N2O3/c1-9-3-5-12(10(2)7-9)18-8-11-4-6-13(19-11)14(17)16-15/h3-7H,8,15H2,1-2H3,(H,16,17)

InChI key: InChIKey=LNSRMIZOLZVCRK-UHFFFAOYSA-N

SMILES: C(OC1=C(C)C=C(C)C=C1)C=2OC(C(NN)=O)=CC2

Synonyms:

• 5-[(2,4-Dimethylphenoxy)methyl]-2-furancarboxylic acid hydrazide
• 2-Furancarboxylic acid, 5-[(2,4-dimethylphenoxy)methyl]-, hydrazide