CAS 832738-00-8

1-(Ethylsulfonyl)-3-piperidinecarboxylic acid hydrazide

Description:

1-(Ethylsulfonyl)-3-piperidinecarboxylic acid hydrazide, identified by its CAS number 832738-00-8, is a chemical compound characterized by its unique functional groups, which include a piperidine ring, a hydrazide moiety, and an ethylsulfonyl group. This compound typically exhibits properties associated with both hydrazides and sulfonyl compounds, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydrazide functional group. The piperidine ring contributes to its cyclic structure, which can influence its biological activity and solubility. Additionally, the ethylsulfonyl group may enhance the compound's stability and solubility in polar solvents. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, where it may exhibit various biological activities. However, specific applications and biological effects would require further investigation through empirical studies.

Formula: C₈H₁₇N₃O₃S

InChI: InChI=1S/C8H17N3O3S/c1-2-15(13,14)11-5-3-4-7(6-11)8(12)10-9/h7H,2-6,9H2,1H3,(H,10,12)

InChI key: InChIKey=LWTFUEQCTQRQLA-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)N1CC(C(NN)=O)CCC1

Synonyms:

• 1-(Ethylsulfonyl)-3-piperidinecarboxylic acid hydrazide
• 3-Piperidinecarboxylic acid, 1-(ethylsulfonyl)-, hydrazide