CymitQuimica logo

CAS 832738-01-9

:

1-[4-(Difluoromethoxy)phenyl]-3-(dimethylamino)-2-propen-1-one

Description:
1-[4-(Difluoromethoxy)phenyl]-3-(dimethylamino)-2-propen-1-one, with the CAS number 832738-01-9, is an organic compound characterized by its unique structural features. It contains a propenone backbone, which is a conjugated system that contributes to its reactivity and potential applications in organic synthesis. The presence of a difluoromethoxy group enhances its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and electrophilic additions. The dimethylamino group introduces basicity and can influence the compound's solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties, potentially acting as a precursor or intermediate in the synthesis of more complex molecules. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its biological activity, stability, and environmental impact would be necessary to fully understand its characteristics and potential uses.
Formula:C12H13F2NO2
InChI:InChI=1S/C12H13F2NO2/c1-15(2)8-7-11(16)9-3-5-10(6-4-9)17-12(13)14/h3-8,12H,1-2H3
InChI key:InChIKey=BWMZYULNGCTDMB-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=CC=C(OC(F)F)C=C1
Synonyms:
  • 2-Propen-1-one, 1-[4-(difluoromethoxy)phenyl]-3-(dimethylamino)-
  • 1-[4-(Difluoromethoxy)phenyl]-3-(dimethylamino)-2-propen-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.