CymitQuimica logo

CAS 832738-03-1

:

5-[(3-Chloro-4-fluorophenoxy)methyl]-2-furancarboxylic acid hydrazide

Description:
5-[(3-Chloro-4-fluorophenoxy)methyl]-2-furancarboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a furancarboxylic acid moiety and a hydrazide functional group. This compound features a chloro and fluorine substituent on a phenoxy group, contributing to its potential biological activity and chemical reactivity. The presence of the hydrazide functional group suggests that it may participate in various chemical reactions, including hydrazone formation and potential interactions with biological targets. The furancarboxylic acid component may impart specific properties such as solubility and stability in various solvents. This compound is of interest in medicinal chemistry and may be explored for its pharmacological properties, particularly in the development of new therapeutic agents. Its specific characteristics, including melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H10ClFN2O3
InChI:InChI=1S/C12H10ClFN2O3/c13-9-5-7(1-3-10(9)14)18-6-8-2-4-11(19-8)12(17)16-15/h1-5H,6,15H2,(H,16,17)
InChI key:InChIKey=KQFBWTUMPJPLBQ-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=C(F)C=C1)C=2OC(C(NN)=O)=CC2
Synonyms:
  • 2-Furancarboxylic acid, 5-[(3-chloro-4-fluorophenoxy)methyl]-, hydrazide
  • 5-[(3-Chloro-4-fluorophenoxy)methyl]-2-furancarboxylic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.