CAS 832738-08-6
:α-Methyl-4-(1H-pyrrol-1-yl)benzenemethanamine
Description:
α-Methyl-4-(1H-pyrrol-1-yl)benzenemethanamine, with the CAS number 832738-08-6, is a chemical compound that belongs to the class of substituted phenethylamines. It features a phenyl ring substituted with a pyrrole moiety and an amino group, contributing to its potential biological activity. The presence of the α-methyl group enhances its lipophilicity, which may influence its ability to cross biological membranes. This compound is of interest in medicinal chemistry and pharmacology due to its structural similarity to various psychoactive substances. Its properties may include moderate solubility in organic solvents and potential reactivity due to the amino group, which can participate in various chemical reactions. The compound's pharmacological profile, including its mechanism of action and therapeutic potential, would require further investigation through experimental studies. Safety and handling precautions should be observed, as with any chemical substance, particularly those with psychoactive properties.
Formula:C12H14N2
InChI:InChI=1S/C12H14N2/c1-10(13)11-4-6-12(7-5-11)14-8-2-3-9-14/h2-10H,13H2,1H3
InChI key:InChIKey=LMLXFODTRVVPKY-UHFFFAOYSA-N
SMILES:C(C)(N)C1=CC=C(C=C1)N2C=CC=C2
Synonyms:- 1-[4-(1H-Pyrrol-1-yl)phenyl]ethan-1-amine
- Benzenemethanamine, α-methyl-4-(1H-pyrrol-1-yl)-
- 1-(4-(1H-Pyrrol-1-yl)phenyl)ethanamine
- 1-(4-Pyrrol-1-ylphenyl)ethanamine
- α-Methyl-4-(1H-pyrrol-1-yl)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.