CymitQuimica logo

CAS 832738-10-0

:

1-[(2-Chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine

Description:
1-[(2-Chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a chloro and a fluorine substituent on a phenyl group, contributing to its unique chemical properties and potential biological activity. The presence of the amine functional group enhances its reactivity and solubility in various solvents. It is often studied for its potential applications in pharmaceuticals, particularly as an antifungal or antimicrobial agent, due to the triazole moiety's known efficacy in inhibiting certain enzyme pathways in pathogens. The compound's molecular structure allows for interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, its stability and solubility characteristics can vary based on environmental conditions, influencing its behavior in biological systems. Overall, this compound exemplifies the complexity and utility of heterocyclic compounds in drug development and chemical research.
Formula:C9H8ClFN4
InChI:InChI=1S/C9H8ClFN4/c10-7-2-1-3-8(11)6(7)4-15-5-13-9(12)14-15/h1-3,5H,4H2,(H2,12,14)
InChI key:InChIKey=KDFPXBZARAYDLS-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)C=CC=C1F)N2N=C(N)N=C2
Synonyms:
  • 1H-1,2,4-Triazol-3-amine, 1-[(2-chloro-6-fluorophenyl)methyl]-
  • 1-[(2-Chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.