CAS 832738-15-5
:1-[4-(1H-Pyrrol-1-yl)phenyl]ethanone oxime
Description:
1-[4-(1H-Pyrrol-1-yl)phenyl]ethanone oxime, with the CAS number 832738-15-5, is an organic compound characterized by its oxime functional group, which is derived from the reaction of an aldehyde or ketone with hydroxylamine. This compound features a phenyl ring substituted with a pyrrole moiety, contributing to its unique chemical properties and potential biological activity. The presence of the oxime group suggests that it may participate in various chemical reactions, such as condensation or rearrangement, and could serve as a precursor for further synthetic modifications. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the molecular structure indicates potential for hydrogen bonding and interactions with biological targets. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent used. Overall, 1-[4-(1H-Pyrrol-1-yl)phenyl]ethanone oxime represents a class of compounds that could be explored for various applications in research and industry.
Formula:C12H12N2O
InChI:InChI=1S/C12H12N2O/c1-10(13-15)11-4-6-12(7-5-11)14-8-2-3-9-14/h2-9,15H,1H3
InChI key:InChIKey=PXPFQUACXGFCRJ-UHFFFAOYSA-N
SMILES:C(=NO)(C)C1=CC=C(C=C1)N2C=CC=C2
Synonyms:- Ethanone, 1-[4-(1H-pyrrol-1-yl)phenyl]-, oxime
- 1-[4-(1H-Pyrrol-1-yl)phenyl]ethanone oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.