CAS 832738-18-8
:5-[(4-Bromo-2-chlorophenoxy)methyl]-2-furancarboxylic acid hydrazide
Description:
5-[(4-Bromo-2-chlorophenoxy)methyl]-2-furancarboxylic acid hydrazide, with the CAS number 832738-18-8, is a chemical compound characterized by its unique structure that includes a furan ring, a hydrazide functional group, and halogenated aromatic moieties. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydrazide group. The bromine and chlorine substituents on the aromatic ring can influence its electronic properties, potentially enhancing its reactivity or altering its solubility in various solvents. Additionally, the furan ring contributes to the compound's stability and may impart specific biological activities, making it of interest in pharmaceutical research. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies would be necessary to fully understand its biological activity and practical applications.
Formula:C12H10BrClN2O3
InChI:InChI=1S/C12H10BrClN2O3/c13-7-1-3-10(9(14)5-7)18-6-8-2-4-11(19-8)12(17)16-15/h1-5H,6,15H2,(H,16,17)
InChI key:InChIKey=NYLNPUBHELIGGT-UHFFFAOYSA-N
SMILES:C(OC1=C(Cl)C=C(Br)C=C1)C=2OC(C(NN)=O)=CC2
Synonyms:- 2-Furancarboxylic acid, 5-[(4-bromo-2-chlorophenoxy)methyl]-, hydrazide
- 5-[(4-Bromo-2-chlorophenoxy)methyl]-2-furancarboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.