
CAS 832738-21-3
:2-Bromo-1,3-bis(3,4-dimethoxyphenyl)-1,3-propanedione
Description:
2-Bromo-1,3-bis(3,4-dimethoxyphenyl)-1,3-propanedione is an organic compound characterized by its unique structure, which includes a bromine atom and two 3,4-dimethoxyphenyl groups attached to a central propanedione moiety. This compound typically exhibits properties associated with diketones, such as the ability to undergo enolization and participate in various chemical reactions, including nucleophilic additions and condensation reactions. The presence of the bromine atom can enhance its reactivity, making it a potential candidate for further chemical modifications. The methoxy groups contribute to the compound's solubility and can influence its electronic properties, potentially affecting its reactivity and interaction with biological systems. Additionally, compounds with similar structures are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their ability to interact with biological targets or serve as intermediates in synthetic pathways. Overall, 2-Bromo-1,3-bis(3,4-dimethoxyphenyl)-1,3-propanedione represents a versatile structure with significant implications in organic chemistry.
Formula:C19H19BrO6
InChI:InChI=1S/C19H19BrO6/c1-23-13-7-5-11(9-15(13)25-3)18(21)17(20)19(22)12-6-8-14(24-2)16(10-12)26-4/h5-10,17H,1-4H3
InChI key:InChIKey=NQLFCELQPKLXPG-UHFFFAOYSA-N
SMILES:C(C(C(=O)C1=CC(OC)=C(OC)C=C1)Br)(=O)C2=CC(OC)=C(OC)C=C2
Synonyms:- 2-Bromo-1,3-bis(3,4-dimethoxyphenyl)-1,3-propanedione
- 1,3-Propanedione, 2-bromo-1,3-bis(3,4-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.