CAS 832738-22-4

Methyl 5-[(4-bromo-2-nitrophenoxy)methyl]-2-furancarboxylate

Description:

Methyl 5-[(4-bromo-2-nitrophenoxy)methyl]-2-furancarboxylate is an organic compound characterized by its complex structure, which includes a furan ring, a carboxylate group, and a nitrophenoxy moiety. This compound typically exhibits a moderate to high polarity due to the presence of the nitro and bromo substituents, which can influence its solubility in various solvents. The furan ring contributes to its aromatic properties, while the carboxylate group can participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. The presence of the bromine and nitro groups may impart specific electronic properties, making it a potential candidate for applications in pharmaceuticals or agrochemicals. Additionally, the compound's synthesis and stability can be influenced by the functional groups present, which may also affect its biological activity. Overall, Methyl 5-[(4-bromo-2-nitrophenoxy)methyl]-2-furancarboxylate is a compound of interest in organic chemistry, particularly for its potential applications in various fields.

Formula: C₁₃H₁₀BrNO₆

InChI: InChI=1S/C13H10BrNO6/c1-19-13(16)12-5-3-9(21-12)7-20-11-4-2-8(14)6-10(11)15(17)18/h2-6H,7H2,1H3

InChI key: InChIKey=JICDLBSFRXHVFL-UHFFFAOYSA-N

SMILES: O(CC=1OC(C(OC)=O)=CC1)C2=C(N(=O)=O)C=C(Br)C=C2

Synonyms:

• 2-Furancarboxylic acid, 5-[(4-bromo-2-nitrophenoxy)methyl]-, methyl ester
• Methyl 5-[(4-bromo-2-nitrophenoxy)methyl]-2-furancarboxylate