CAS 832739-22-7
:Methyl 3-[[(2,3-dihydro-1H-inden-5-yl)oxy]methyl]benzoate
Description:
Methyl 3-[[(2,3-dihydro-1H-inden-5-yl)oxy]methyl]benzoate, identified by its CAS number 832739-22-7, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and methanol. This compound features a complex structure that includes a methyl ester group and an indene derivative, contributing to its potential biological activity. The presence of the indene moiety suggests that it may exhibit interesting chemical properties, including potential reactivity and interactions with biological systems. Methyl esters are generally known for their solubility in organic solvents and moderate polarity, which can influence their behavior in various chemical reactions and applications. The compound may be of interest in medicinal chemistry, materials science, or as a synthetic intermediate due to its unique structural features. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization.
Formula:C18H18O3
InChI:InChI=1S/C18H18O3/c1-20-18(19)16-7-2-4-13(10-16)12-21-17-9-8-14-5-3-6-15(14)11-17/h2,4,7-11H,3,5-6,12H2,1H3
InChI key:InChIKey=YYIMLLCQNPKOAG-UHFFFAOYSA-N
SMILES:O(CC1=CC(C(OC)=O)=CC=C1)C=2C=C3C(=CC2)CCC3
Synonyms:- Methyl 3-[[(2,3-dihydro-1H-inden-5-yl)oxy]methyl]benzoate
- Benzoic acid, 3-[[(2,3-dihydro-1H-inden-5-yl)oxy]methyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.