CymitQuimica logo

CAS 832739-23-8

:

Methyl 5-[(5-fluoro-2-nitrophenoxy)methyl]-2-furancarboxylate

Description:
Methyl 5-[(5-fluoro-2-nitrophenoxy)methyl]-2-furancarboxylate, identified by its CAS number 832739-23-8, is an organic compound characterized by its furan and nitrophenyl functional groups. This compound features a furan ring, which is a five-membered aromatic heterocycle containing oxygen, and a carboxylate group that contributes to its reactivity and solubility in various solvents. The presence of a nitro group and a fluorine atom on the phenyl ring enhances its electrophilic properties, making it potentially useful in various chemical reactions, including nucleophilic substitutions. The methyl ester functionality indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. This compound may exhibit biological activity due to its structural components, making it of interest in medicinal chemistry and agrochemical applications. Its specific physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods or provided in chemical databases. Overall, this compound represents a versatile structure with potential applications in synthetic organic chemistry.
Formula:C13H10FNO6
InChI:InChI=1S/C13H10FNO6/c1-19-13(16)11-5-3-9(21-11)7-20-12-6-8(14)2-4-10(12)15(17)18/h2-6H,7H2,1H3
InChI key:InChIKey=HULLVLUFVJOLDD-UHFFFAOYSA-N
SMILES:O(CC=1OC(C(OC)=O)=CC1)C2=C(N(=O)=O)C=CC(F)=C2
Synonyms:
  • 2-Furancarboxylic acid, 5-[(5-fluoro-2-nitrophenoxy)methyl]-, methyl ester
  • Methyl 5-[(5-fluoro-2-nitrophenoxy)methyl]-2-furancarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.