CAS 832739-28-3
:10-Cyclopropyl-8-(trifluoromethyl)pyrido[2′,3′:3,4]pyrazolo[1,5-a]pyrimidine
Description:
10-Cyclopropyl-8-(trifluoromethyl)pyrido[2′,3′:3,4]pyrazolo[1,5-a]pyrimidine is a synthetic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrazole moieties. The presence of a cyclopropyl group and a trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound is often studied for its pharmacological potential, particularly in the context of medicinal chemistry, where modifications to the core structure can influence its interaction with biological targets. The trifluoromethyl group is known to enhance metabolic stability and can affect the compound's solubility and permeability. Additionally, the compound's structural features may allow it to participate in various chemical reactions, making it a candidate for further research in drug development. Its CAS number, 832739-28-3, serves as a unique identifier for regulatory and research purposes, facilitating its study in scientific literature and databases.
Formula:C13H9F3N4
InChI:InChI=1S/C13H9F3N4/c14-13(15,16)9-6-8(7-2-3-7)10-11(18-9)19-20-5-1-4-17-12(10)20/h1,4-7H,2-3H2
InChI key:InChIKey=PDZPBKVAYJQLJH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=2C(=NN3C2N=CC=C3)N1)C4CC4
Synonyms:- 10-Cyclopropyl-8-(trifluoromethyl)pyrido[2′,3′:3,4]pyrazolo[1,5-a]pyrimidine
- Pyrido[2′,3′:3,4]pyrazolo[1,5-a]pyrimidine, 10-cyclopropyl-8-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.