CAS 832739-32-9
:3-(Difluoromethyl)-6-(2,4-difluorophenyl)-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine
Description:
3-(Difluoromethyl)-6-(2,4-difluorophenyl)-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine is a heterocyclic compound characterized by its complex structure, which includes a triazole and thiadiazine moiety. This compound features a difluoromethyl group and a difluorophenyl substituent, contributing to its unique chemical properties and potential biological activity. The presence of fluorine atoms often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The triazole ring is known for its ability to form hydrogen bonds, which can influence the compound's interactions with biological targets. Additionally, the thiadiazine component may impart specific reactivity or biological properties, potentially making it useful in pharmaceutical applications. The compound's CAS number, 832739-32-9, allows for easy identification and retrieval of information in chemical databases. Overall, this substance exemplifies the complexity and diversity of synthetic organic compounds, particularly in the context of drug discovery and development.
Formula:C11H6F4N4S
InChI:InChI=1S/C11H6F4N4S/c12-5-1-2-6(7(13)3-5)8-4-20-11-17-16-10(9(14)15)19(11)18-8/h1-3,9H,4H2
InChI key:InChIKey=SENVARVUHJWEJO-UHFFFAOYSA-N
SMILES:C(F)(F)C=1N2C(SCC(=N2)C3=C(F)C=C(F)C=C3)=NN1
Synonyms:- 7H-1,2,4-Triazolo[3,4-b][1,3,4]thiadiazine, 3-(difluoromethyl)-6-(2,4-difluorophenyl)-
- 3-(Difluoromethyl)-6-(2,4-difluorophenyl)-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.