CymitQuimica logo

CAS 832739-36-3

:

1,3-Bis(3,4-dimethoxyphenyl)-2-methyl-1,3-propanedione

Description:
1,3-Bis(3,4-dimethoxyphenyl)-2-methyl-1,3-propanedione, identified by its CAS number 832739-36-3, is an organic compound characterized by its complex structure featuring two 3,4-dimethoxyphenyl groups attached to a central 2-methyl-1,3-propanedione moiety. This compound typically exhibits properties associated with diketones, including potential reactivity in condensation reactions and the ability to participate in various organic transformations. Its methoxy substituents enhance its solubility in organic solvents and may influence its electronic properties, making it of interest in fields such as organic synthesis and materials science. The presence of multiple aromatic rings suggests potential applications in the development of organic light-emitting diodes (OLEDs) or as intermediates in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting biological activities, although specific studies would be necessary to elucidate its pharmacological properties. Overall, 1,3-Bis(3,4-dimethoxyphenyl)-2-methyl-1,3-propanedione represents a versatile building block in organic chemistry.
Formula:C20H22O6
InChI:InChI=1S/C20H22O6/c1-12(19(21)13-6-8-15(23-2)17(10-13)25-4)20(22)14-7-9-16(24-3)18(11-14)26-5/h6-12H,1-5H3
InChI key:InChIKey=OEAUUUDSJCPUBJ-UHFFFAOYSA-N
SMILES:C(C(C(=O)C1=CC(OC)=C(OC)C=C1)C)(=O)C2=CC(OC)=C(OC)C=C2
Synonyms:
  • 1,3-Bis(3,4-dimethoxyphenyl)-2-methyl-1,3-propanedione
  • 1,3-Propanedione, 1,3-bis(3,4-dimethoxyphenyl)-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.