CAS 832739-38-5

1-[3-(1H-Pyrrol-1-yl)phenyl]ethanone oxime

Description:

1-[3-(1H-Pyrrol-1-yl)phenyl]ethanone oxime, with the CAS number 832739-38-5, is an organic compound characterized by its oxime functional group, which is derived from the corresponding ketone. This substance features a phenyl ring substituted with a pyrrole moiety, contributing to its unique chemical properties and potential biological activity. The presence of the oxime group suggests that it may participate in various chemical reactions, such as condensation or rearrangement, and could serve as a precursor for further synthetic modifications. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components that can influence biological interactions. Additionally, its solubility and stability in different solvents can vary, which is essential for its practical applications in research and industry. Overall, 1-[3-(1H-Pyrrol-1-yl)phenyl]ethanone oxime represents a versatile compound with interesting chemical behavior and potential utility in various fields.

Formula: C₁₂H₁₂N₂O

InChI: InChI=1S/C12H12N2O/c1-10(13-15)11-5-4-6-12(9-11)14-7-2-3-8-14/h2-9,15H,1H3

InChI key: InChIKey=XDGZSGIGBYNFFS-UHFFFAOYSA-N

SMILES: C(=NO)(C)C=1C=C(C=CC1)N2C=CC=C2

Synonyms:

• 1-[3-(1H-Pyrrol-1-yl)phenyl]ethanone oxime
• Ethanone, 1-[3-(1H-pyrrol-1-yl)phenyl]-, oxime

(1E)-1-[3-(1H-Pyrrol-1-yl)phenyl]ethanone oxime

CAS: 832739-38-5

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂O

Purity: Min. 95%

Molecular weight: 200.24 g/mol

Ref: 3D-HIB73938