CAS 832739-39-6: 5-[(4-Methoxyphenoxy)methyl]-2-furancarboxylic acid

Description:5-[(4-Methoxyphenoxy)methyl]-2-furancarboxylic acid is an organic compound characterized by its unique structure, which includes a furan ring and a methoxyphenyl group. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The furan ring is known for its aromatic properties and can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry. Additionally, the compound may exhibit specific pharmacological properties, which could be explored in medicinal chemistry. Its CAS number, 832739-39-6, serves as a unique identifier for regulatory and research purposes. Overall, this compound's structural characteristics suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.

Formula:C₁₃H₁₂O₅

InChI:InChI=1S/C13H12O5/c1-16-9-2-4-10(5-3-9)17-8-11-6-7-12(18-11)13(14)15/h2-7H,8H2,1H3,(H,14,15)

InChI key:InChIKey=HDFIQJWOUCMCRF-UHFFFAOYSA-N

SMILES:O=C(O)C=1OC(=CC1)COC2=CC=C(OC)C=C2