CymitQuimica logo

CAS 832739-49-8

:

3-(Difluoromethyl)-6-phenyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine

Description:
3-(Difluoromethyl)-6-phenyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine is a heterocyclic compound characterized by its complex structure, which includes a triazole and thiadiazine moiety. This compound features a difluoromethyl group, which enhances its reactivity and potential biological activity. The presence of a phenyl group contributes to its aromatic characteristics, influencing its solubility and stability. The unique arrangement of nitrogen and sulfur atoms within the ring structure imparts specific electronic properties, making it of interest in medicinal chemistry and material science. Its CAS number, 832739-49-8, allows for easy identification in chemical databases. The compound may exhibit various pharmacological activities, potentially serving as a lead compound in drug discovery. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be evaluated for its efficacy and safety in biological systems. Overall, this compound represents a fascinating area of study due to its structural complexity and potential applications.
Formula:C11H8F2N4S
InChI:InChI=1S/C11H8F2N4S/c12-9(13)10-14-15-11-17(10)16-8(6-18-11)7-4-2-1-3-5-7/h1-5,9H,6H2
InChI key:InChIKey=RYSNMYMVMLBWCX-UHFFFAOYSA-N
SMILES:C(F)(F)C=1N2C(=NN1)SCC(=N2)C3=CC=CC=C3
Synonyms:
  • 3-(Difluoromethyl)-6-phenyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine
  • 7H-1,2,4-Triazolo[3,4-b][1,3,4]thiadiazine, 3-(difluoromethyl)-6-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.