CAS 832739-63-6
:2-Chloro-1,3-bis(3-methoxyphenyl)-1,3-propanedione
Description:
2-Chloro-1,3-bis(3-methoxyphenyl)-1,3-propanedione, identified by its CAS number 832739-63-6, is an organic compound characterized by its unique structure featuring a chloro substituent and two methoxyphenyl groups attached to a central propanedione moiety. This compound typically exhibits properties associated with diketones, including potential reactivity in condensation reactions and the ability to participate in various organic transformations. The presence of the chloro group may enhance its electrophilic character, making it a useful intermediate in synthetic organic chemistry. Additionally, the methoxy groups can influence the compound's solubility and polarity, affecting its behavior in different solvents. The compound may also display biological activity, which could be of interest in medicinal chemistry. Overall, 2-Chloro-1,3-bis(3-methoxyphenyl)-1,3-propanedione serves as a versatile building block in chemical synthesis, with potential applications in pharmaceuticals and agrochemicals.
Formula:C17H15ClO4
InChI:InChI=1S/C17H15ClO4/c1-21-13-7-3-5-11(9-13)16(19)15(18)17(20)12-6-4-8-14(10-12)22-2/h3-10,15H,1-2H3
InChI key:InChIKey=OTFWBAICUDBIPT-UHFFFAOYSA-N
SMILES:C(C(C(=O)C1=CC(OC)=CC=C1)Cl)(=O)C2=CC(OC)=CC=C2
Synonyms:- 2-Chloro-1,3-bis(3-methoxyphenyl)-1,3-propanedione
- 1,3-Propanedione, 2-chloro-1,3-bis(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.