CAS 832739-68-1

4-(Difluoromethyl)-2-(ethylsulfonyl)-6-(4-fluorophenyl)pyrimidine

Description:

4-(Difluoromethyl)-2-(ethylsulfonyl)-6-(4-fluorophenyl)pyrimidine is a synthetic organic compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound features a difluoromethyl group, which enhances its reactivity and lipophilicity, making it potentially useful in medicinal chemistry. The ethylsulfonyl group contributes to its solubility and may influence its biological activity by participating in various interactions with biological targets. Additionally, the presence of a 4-fluorophenyl substituent can affect the compound's electronic properties and steric hindrance, which are crucial for its interaction with enzymes or receptors. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of targeted therapies. Its specific characteristics, such as melting point, solubility, and biological activity, would require empirical investigation to fully understand its behavior in various chemical and biological contexts.

Formula: C₁₃H₁₁F₃N₂O₂S

InChI: InChI=1S/C13H11F3N2O2S/c1-2-21(19,20)13-17-10(7-11(18-13)12(15)16)8-3-5-9(14)6-4-8/h3-7,12H,2H2,1H3

InChI key: InChIKey=DSPCAEHOPVYWLS-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)C=1N=C(C=C(C(F)F)N1)C2=CC=C(F)C=C2

Synonyms:

• 4-(Difluoromethyl)-2-(ethylsulfonyl)-6-(4-fluorophenyl)pyrimidine
• Pyrimidine, 4-(difluoromethyl)-2-(ethylsulfonyl)-6-(4-fluorophenyl)-

4-(Difluoromethyl)-2-(ethylsulfonyl)-6-(4-fluorophenyl)pyrimidine

CAS: 832739-68-1

Versatile small molecule scaffold

Formula: C₁₃H₁₁F₃N₂O₂S

Purity: Min. 95%

Molecular weight: 316.3 g/mol

Ref: 3D-HIB73968