CymitQuimica logo

CAS 832739-88-5

:

4-Cyclopropyl-6-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-3-amine

Description:
4-Cyclopropyl-6-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-3-amine is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazolo[3,4-b]pyridine core. This compound features a cyclopropyl group and a trifluoromethyl group, contributing to its distinct chemical properties and potential biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The amine functional group can participate in hydrogen bonding, influencing the compound's solubility and reactivity. This substance may exhibit various pharmacological activities, potentially acting as a kinase inhibitor or having other therapeutic applications. Its specific interactions and efficacy would depend on the molecular context and biological targets. As with many compounds containing fluorine, it may also exhibit unique environmental and toxicological profiles. Overall, 4-Cyclopropyl-6-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-3-amine represents a class of compounds that are valuable in drug discovery and development.
Formula:C10H9F3N4
InChI:InChI=1S/C10H9F3N4/c11-10(12,13)6-3-5(4-1-2-4)7-8(14)16-17-9(7)15-6/h3-4H,1-2H2,(H3,14,15,16,17)
InChI key:InChIKey=WNNDGUOKKFRGPF-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=C(C(F)(F)F)N=C2NN1)C3CC3
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridin-3-amine, 4-cyclopropyl-6-(trifluoromethyl)-
  • 4-Cyclopropyl-6-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.