CymitQuimica logo

CAS 832739-89-6

:

5-[(4-Chloro-2-methylphenoxy)methyl]-2-furancarboxylic acid

Description:
5-[(4-Chloro-2-methylphenoxy)methyl]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. The presence of a chloro-substituted aromatic ring contributes to its potential biological activity and reactivity. This compound is likely to exhibit moderate solubility in organic solvents due to the furan and aromatic components, while its carboxylic acid group may enhance its solubility in polar solvents. The compound's molecular structure suggests it could participate in various chemical reactions, including esterification and nucleophilic substitution, making it of interest in synthetic organic chemistry. Additionally, the presence of the chloro group may impart specific pharmacological properties, potentially making it relevant in medicinal chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound's unique features make it a subject of interest for further research and application in various chemical fields.
Formula:C13H11ClO4
InChI:InChI=1S/C13H11ClO4/c1-8-6-9(14)2-4-11(8)17-7-10-3-5-12(18-10)13(15)16/h2-6H,7H2,1H3,(H,15,16)
InChI key:InChIKey=OTZHOWDFRVZJIV-UHFFFAOYSA-N
SMILES:C(OC1=C(C)C=C(Cl)C=C1)C=2OC(C(O)=O)=CC2
Synonyms:
  • 5-[(4-Chloro-2-methylphenoxy)methyl]-2-furancarboxylic acid
  • 2-Furancarboxylic acid, 5-[(4-chloro-2-methylphenoxy)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.