CymitQuimica logo

CAS 832739-90-9

:

3-Amino-2,3-dihydro-6-methyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one

Description:
3-Amino-2,3-dihydro-6-methyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its unique thieno-pyrimidine structure, which incorporates both sulfur and nitrogen atoms. This compound features a thioxo group, contributing to its reactivity and potential biological activity. The presence of an amino group enhances its solubility in polar solvents and may influence its interaction with biological targets. The methyl group at the 6-position can affect the compound's steric properties and overall stability. Typically, such compounds are of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial or anticancer activities. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions or cyclization processes. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Amino-2,3-dihydro-6-methyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one represents a class of compounds that may have significant implications in drug development and synthetic chemistry.
Formula:C7H7N3OS2
InChI:InChI=1S/C7H7N3OS2/c1-3-2-4-5(13-3)9-7(12)10(8)6(4)11/h2H,8H2,1H3,(H,9,12)
InChI key:InChIKey=OQHAZLYXFSSGAN-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(=S)N1N)SC(C)=C2
Synonyms:
  • Thieno[2,3-d]pyrimidin-4(1H)-one, 3-amino-2,3-dihydro-6-methyl-2-thioxo-
  • 3-Amino-2,3-dihydro-6-methyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.