CAS 832739-91-0

Methyl 6-amino-3-chlorobenzo[b]thiophene-2-carboxylate

Description:

Methyl 6-amino-3-chlorobenzo[b]thiophene-2-carboxylate is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core, an amino group, and a carboxylate ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the amino and chloro substituents. The methyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the chlorine atom can influence its electronic properties and reactivity, potentially making it a candidate for further functionalization or as an intermediate in the synthesis of more complex molecules. Additionally, compounds with similar structures have been studied for their biological activities, including antimicrobial and anticancer properties, although specific biological data for this compound may vary. Overall, Methyl 6-amino-3-chlorobenzo[b]thiophene-2-carboxylate represents a versatile scaffold for further chemical exploration.

Formula: C₁₀H₈ClNO₂S

InChI: InChI=1S/C10H8ClNO2S/c1-14-10(13)9-8(11)6-3-2-5(12)4-7(6)15-9/h2-4H,12H2,1H3

InChI key: InChIKey=OHIDFXTUQYNDLX-UHFFFAOYSA-N

SMILES: ClC=1C=2C(SC1C(OC)=O)=CC(N)=CC2

Synonyms:

• Methyl 6-amino-3-chlorobenzo[b]thiophene-2-carboxylate
• Benzo[b]thiophene-2-carboxylic acid, 6-amino-3-chloro-, methyl ester

Methyl 6-amino-3-chloro-1-benzothiophene-2-carboxylate

CAS: 832739-91-0

Versatile small molecule scaffold

Formula: C₁₀H₈ClNO₂S

Purity: Min. 95%

Molecular weight: 241.69 g/mol

Ref: 3D-HIB73991