CAS 832739-98-7
:3-(Chlorodifluoromethyl)-6-phenyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine
Description:
3-(Chlorodifluoromethyl)-6-phenyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine is a heterocyclic compound characterized by its complex structure, which includes a triazole and thiadiazine moiety. This compound features a chlorodifluoromethyl group, contributing to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the phenyl group enhances its stability and may influence its biological activity. The compound's molecular structure suggests it may exhibit interesting electronic properties due to the presence of multiple electronegative atoms, which can affect its interactions with biological targets. Additionally, the halogen substituents, particularly the chlorodifluoromethyl group, can enhance lipophilicity, potentially improving the compound's bioavailability. Overall, this substance may possess significant potential for further research and development, particularly in medicinal chemistry, where its unique structural features could lead to novel therapeutic agents.
Formula:C11H7ClF2N4S
InChI:InChI=1S/C11H7ClF2N4S/c12-11(13,14)9-15-16-10-18(9)17-8(6-19-10)7-4-2-1-3-5-7/h1-5H,6H2
InChI key:InChIKey=NABUMOGHLHWVFL-UHFFFAOYSA-N
SMILES:C(Cl)(F)(F)C=1N2C(=NN1)SCC(=N2)C3=CC=CC=C3
Synonyms:- 7H-1,2,4-Triazolo[3,4-b][1,3,4]thiadiazine, 3-(chlorodifluoromethyl)-6-phenyl-
- 3-(Chlorodifluoromethyl)-6-phenyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazine
- 3-(CHLORO-DIFLUORO-METHYL)-6-PHENYL-7 H-[1,2,4]TRIAZOLO[3,4-B ][1,3,4]THIADIAZINE
- ART-CHEM-BB B014800
- AKOS B014800
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.