CymitQuimica logo

CAS 832740-01-9

:

3-[(2-Chloro-5-methylphenoxy)methyl]benzoic acid hydrazide

Description:
3-[(2-Chloro-5-methylphenoxy)methyl]benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This compound features a chlorinated aromatic ring, specifically a 2-chloro-5-methylphenoxy group, which contributes to its unique properties. The presence of the hydrazide moiety suggests potential biological activity, as hydrazides are often explored for their pharmacological properties. The compound is likely to exhibit moderate solubility in organic solvents due to its aromatic structure, while its hydrophilic carboxylic acid group may enhance solubility in polar solvents. Additionally, the chlorinated aromatic ring may influence its reactivity and interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks. Overall, this compound's structure suggests potential applications in medicinal chemistry and materials science, warranting further investigation into its properties and uses.
Formula:C15H15ClN2O2
InChI:InChI=1S/C15H15ClN2O2/c1-10-5-6-13(16)14(7-10)20-9-11-3-2-4-12(8-11)15(19)18-17/h2-8H,9,17H2,1H3,(H,18,19)
InChI key:InChIKey=LQYZQLKSRIQDRA-UHFFFAOYSA-N
SMILES:C(OC1=C(Cl)C=CC(C)=C1)C2=CC(C(NN)=O)=CC=C2
Synonyms:
  • 3-[(2-Chloro-5-methylphenoxy)methyl]benzoic acid hydrazide
  • Benzoic acid, 3-[(2-chloro-5-methylphenoxy)methyl]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.