CAS 832740-02-0
:Ethyl 2-butylcyclopropanebutanoate
Description:
Ethyl 2-butylcyclopropanebutanoate, identified by its CAS number 832740-02-0, is an organic compound that belongs to the class of esters. Esters are typically characterized by their pleasant fragrances and are commonly found in natural and synthetic flavors and fragrances. This particular compound features a cyclopropane ring, which contributes to its unique structural properties and potential reactivity. The presence of both ethyl and butyl groups in its structure suggests that it may exhibit moderate volatility and solubility in organic solvents. Additionally, the ester functional group indicates that it may undergo hydrolysis in the presence of water or acids, leading to the formation of corresponding acids and alcohols. Ethyl 2-butylcyclopropanebutanoate may have applications in the flavor and fragrance industry, as well as in organic synthesis. However, specific data regarding its physical properties, such as boiling point, melting point, and toxicity, would require further investigation or reference to specialized chemical databases.
Formula:C13H24O2
InChI:InChI=1S/C13H24O2/c1-3-5-7-11-10-12(11)8-6-9-13(14)15-4-2/h11-12H,3-10H2,1-2H3
InChI key:InChIKey=WXULZMBBBOXVLX-UHFFFAOYSA-N
SMILES:C(CCC(OCC)=O)C1C(CCCC)C1
Synonyms:- Cyclopropanebutanoic acid, 2-butyl-, ethyl ester
- Ethyl 2-butylcyclopropanebutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.