CAS 832740-04-2
:3-(2-Methoxyphenoxy)-5-nitrobenzenamine
Description:
3-(2-Methoxyphenoxy)-5-nitrobenzenamine, identified by its CAS number 832740-04-2, is an organic compound characterized by its complex aromatic structure. It features a nitro group (-NO2) and an amine group (-NH2) attached to a benzene ring, which contributes to its potential reactivity and solubility properties. The presence of the methoxy group (-OCH3) and the phenoxy group (-O-phenyl) enhances its electron-donating characteristics, influencing its chemical behavior and interactions. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or materials science. Additionally, the nitro group can serve as a site for further chemical modifications, allowing for the synthesis of derivatives with tailored properties. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H12N2O4
InChI:InChI=1S/C13H12N2O4/c1-18-12-4-2-3-5-13(12)19-11-7-9(14)6-10(8-11)15(16)17/h2-8H,14H2,1H3
InChI key:InChIKey=XIJIMFTYDXLDED-UHFFFAOYSA-N
SMILES:O(C1=CC(N(=O)=O)=CC(N)=C1)C2=C(OC)C=CC=C2
Synonyms:- Benzenamine, 3-(2-methoxyphenoxy)-5-nitro-
- 3-(2-Methoxyphenoxy)-5-nitrobenzenamine
- ART-CHEM-BB B007093
- 3-(2-METHOXYPHENOXY)-5-NITROANILINE
- 3-(2-METHOXY-PHENOXY)-5-NITRO-PHENYLAMINE
- AKOS B007093
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.