CAS 832740-17-7

2-[4-(1H-Tetrazol-1-yl)phenoxy]propanoic acid

Description:

2-[4-(1H-Tetrazol-1-yl)phenoxy]propanoic acid, with the CAS number 832740-17-7, is a chemical compound characterized by its unique structure that includes a tetrazole ring and a phenoxy group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, which can influence its solubility and reactivity. The presence of the tetrazole moiety may impart biological activity, making it of interest in pharmaceutical research. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, while the phenoxy group may enhance its interaction with biological targets. Additionally, the compound's stability and reactivity can be influenced by the pH of the environment, as the carboxylic acid can exist in both protonated and deprotonated forms. Overall, 2-[4-(1H-Tetrazol-1-yl)phenoxy]propanoic acid is a compound of interest in medicinal chemistry, potentially serving as a lead compound for drug development or as a tool in biochemical research.

Formula: C₁₀H₁₀N₄O₃

InChI: InChI=1S/C10H10N4O3/c1-7(10(15)16)17-9-4-2-8(3-5-9)14-6-11-12-13-14/h2-7H,1H3,(H,15,16)

InChI key: InChIKey=LQXQKXFJECQNIC-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)C)C1=CC=C(C=C1)N2C=NN=N2

Synonyms:

• 2-[4-(1H-Tetrazol-1-yl)phenoxy]propanoic acid
• Propanoic acid, 2-[4-(1H-tetrazol-1-yl)phenoxy]-