CAS 832740-19-9
:3-(3-Methoxypropyl)-2-thioxo-4-imidazolidinone
Description:
3-(3-Methoxypropyl)-2-thioxo-4-imidazolidinone, identified by its CAS number 832740-19-9, is a chemical compound that features a thioxo group and an imidazolidinone ring structure. This compound is characterized by its unique combination of a methoxypropyl substituent, which contributes to its solubility and potential biological activity. The thioxo group introduces a sulfur atom, which can enhance reactivity and influence the compound's properties, such as its stability and interaction with other molecules. Typically, compounds of this nature may exhibit a range of biological activities, making them of interest in medicinal chemistry and drug development. The presence of the imidazolidinone core suggests potential applications in pharmaceuticals, particularly in the development of agents targeting various biological pathways. Overall, the characteristics of this compound, including its molecular structure and functional groups, position it as a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C7H12N2O2S
InChI:InChI=1S/C7H12N2O2S/c1-11-4-2-3-9-6(10)5-8-7(9)12/h2-5H2,1H3,(H,8,12)
InChI key:InChIKey=PZYUQJFYANXBLO-UHFFFAOYSA-N
SMILES:C(CCOC)N1C(=O)CNC1=S
Synonyms:- 3-(3-Methoxypropyl)-2-thioxo-4-imidazolidinone
- 4-Imidazolidinone, 3-(3-methoxypropyl)-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.