CAS 832740-21-3

5-[(2-Chloro-5-nitrophenoxy)methyl]-2-furancarboxylic acid

Description:

5-[(2-Chloro-5-nitrophenoxy)methyl]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. The presence of a chloro and nitro substituent on the phenoxy group contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic and polar functional groups. Its molecular structure suggests potential for hydrogen bonding, which may influence its physical properties such as melting point and boiling point. Additionally, the presence of the nitro group may impart specific electronic properties, making it a candidate for further chemical modifications or reactions. Safety and handling precautions should be observed, as compounds with halogen and nitro groups can pose health risks. Overall, this compound's unique characteristics make it of interest for research and development in synthetic chemistry and related applications.

Formula: C₁₂H₈ClNO₆

InChI: InChI=1S/C12H8ClNO6/c13-9-3-1-7(14(17)18)5-11(9)19-6-8-2-4-10(20-8)12(15)16/h1-5H,6H2,(H,15,16)

InChI key: InChIKey=JGVKGMGYFKJJLF-UHFFFAOYSA-N

SMILES: O(CC=1OC(C(O)=O)=CC1)C2=CC(N(=O)=O)=CC=C2Cl

Synonyms:

• 2-Furancarboxylic acid, 5-[(2-chloro-5-nitrophenoxy)methyl]-
• 5-[(2-Chloro-5-nitrophenoxy)methyl]-2-furancarboxylic acid
• 5-[(2-Chloro-5-nitrophenoxy)methyl]-2-furoic acid

5-[(2-Chloro-5-nitrophenoxy)methyl]furan-2-carboxylic acid

CAS: 832740-21-3

Versatile small molecule scaffold

Formula: C₁₂H₈ClNO₆

Purity: Min. 95%

Molecular weight: 297.65 g/mol

Ref: 3D-HIB74021