CAS 832740-27-9

5-Phenyl-N-propyl-1,3,4-oxadiazole-2-methanamine

Description:

5-Phenyl-N-propyl-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a phenyl group and a propyl chain, contributing to its unique properties and potential applications in various fields, including pharmaceuticals and materials science. The presence of the amine functional group indicates that it may exhibit basic properties and can participate in hydrogen bonding, influencing its solubility and reactivity. The oxadiazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could lead to the development of novel therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by the substituents on the oxadiazole ring and the amine group, making it a subject of study for researchers exploring new chemical entities.

Formula: C₁₂H₁₅N₃O

InChI: InChI=1S/C12H15N3O/c1-2-8-13-9-11-14-15-12(16-11)10-6-4-3-5-7-10/h3-7,13H,2,8-9H2,1H3

InChI key: InChIKey=ULQMOTCPKQUPDH-UHFFFAOYSA-N

SMILES: C(NCCC)C=1OC(=NN1)C2=CC=CC=C2

Synonyms:

• 5-Phenyl-N-propyl-1,3,4-oxadiazole-2-methanamine
• 1,3,4-Oxadiazole-2-methanamine, 5-phenyl-N-propyl-