CAS 832740-28-0

5-[(4-Methoxyphenoxy)methyl]-2-furancarboxylic acid hydrazide

Description:

5-[(4-Methoxyphenoxy)methyl]-2-furancarboxylic acid hydrazide, identified by its CAS number 832740-28-0, is a chemical compound characterized by its unique structural features, which include a furancarboxylic acid moiety and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and aromatic ethers, potentially influencing its solubility, reactivity, and biological activity. The presence of the methoxyphenoxy group may enhance its lipophilicity, allowing for better membrane permeability, while the hydrazide functionality can participate in various chemical reactions, including condensation and hydrazone formation. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or antimicrobial activities. Additionally, the furan ring can contribute to the compound's stability and reactivity under different conditions. Overall, the characteristics of this compound suggest it may have applications in drug development or as a biochemical probe, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₃H₁₄N₂O₄

InChI: InChI=1S/C13H14N2O4/c1-17-9-2-4-10(5-3-9)18-8-11-6-7-12(19-11)13(16)15-14/h2-7H,8,14H2,1H3,(H,15,16)

InChI key: InChIKey=NXKZDAIBINNEMT-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(OC)C=C1)C=2OC(C(NN)=O)=CC2

Synonyms:

• 2-Furancarboxylic acid, 5-[(4-methoxyphenoxy)methyl]-, hydrazide
• 5-[(4-Methoxyphenoxy)methyl]-2-furancarboxylic acid hydrazide