CAS 832740-30-4

3-[(4-Chloro-2-methylphenoxy)methyl]benzoic acid

Description:

3-[(4-Chloro-2-methylphenoxy)methyl]benzoic acid, identified by its CAS number 832740-30-4, is an organic compound characterized by its benzoic acid structure modified with a phenoxy group. This compound features a chloro and a methyl substituent on the aromatic ring, which can influence its chemical reactivity and biological activity. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit polar characteristics, contributing to its solubility in polar solvents. The chloro substituent can enhance the compound's lipophilicity, potentially affecting its interaction with biological systems. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and applications could be relevant in various fields, including agrochemicals or pharmaceuticals, depending on its biological activity. Overall, the unique combination of functional groups and structural features gives this compound distinct chemical properties that warrant further investigation.

Formula: C₁₅H₁₃ClO₃

InChI: InChI=1S/C15H13ClO3/c1-10-7-13(16)5-6-14(10)19-9-11-3-2-4-12(8-11)15(17)18/h2-8H,9H2,1H3,(H,17,18)

InChI key: InChIKey=FKROTSBHFRRBNI-UHFFFAOYSA-N

SMILES: C(OC1=C(C)C=C(Cl)C=C1)C2=CC(C(O)=O)=CC=C2

Synonyms:

• 3-[(4-Chloro-2-methylphenoxy)methyl]benzoic acid
• Benzoic acid, 3-[(4-chloro-2-methylphenoxy)methyl]-